About (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one
(E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one (PubChem CID 139041832) has the molecular formula C52H38N2O2
and a molecular weight of 722.89 g/mol. Its IUPAC name is (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one |
| PubChem CID | 139041832 |
| Molecular Formula | C52H38N2O2 |
| Molecular Weight | 722.89 g/mol |
| Exact Mass | 722.29 |
| IUPAC Name | (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1-c1ccccn1.O=C(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/2C26H19NO/c2*28-26(23-16-8-7-15-22(23)25-17-9-10-18-27-25)24(21-13-5-2-6-14-21)19-20-11-3-1-4-12-20/h2*1-19H/b2*24-19+ |
| InChIKey | CBCDSTXYVXOCHJ-PKYSBZSPSA-N |
| XLogP | 12.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.89 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one?
The IUPAC name of (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one (CID 139041832) is (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one is O=C(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1-c1ccccn1.O=C(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1-c1ccccn1.
What is the InChIKey of (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one?
The InChIKey is CBCDSTXYVXOCHJ-PKYSBZSPSA-N. The full InChI is InChI=1S/2C26H19NO/c2*28-26(23-16-8-7-15-22(23)25-17-9-10-18-27-25)24(21-13-5-2-6-14-21)19-20-11-3-1-4-12-20/h2*1-19H/b2*24-19+.
What are the key properties of (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one?
(E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one has a molecular weight of 722.89 g/mol, XLogP of 12.34, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-diphenyl-1-(2-pyridin-2-ylphenyl)prop-2-en-1-one is sourced from PubChem (CID 139041832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).