C17H16F3N3 — CID 139042151
7-butyl-3-[4-(trifluoromethyl)phenyl]triazolo[1,5-a]pyridine (PubChem CID 139042151) has the molecular formula C17H16F3N3 and a molecular weight of 319.33 g/mol. Its IUPAC name is 7-butyl-3-[4-(trifluoromethyl)phenyl]triazolo[1,5-a]pyridine.
| Compound Name | 7-butyl-3-[4-(trifluoromethyl)phenyl]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 139042151 |
| Molecular Formula | C17H16F3N3 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 7-butyl-3-[4-(trifluoromethyl)phenyl]triazolo[1,5-a]pyridine |
| SMILES | CCCCc1cccc2c(-c3ccc(C(F)(F)F)cc3)nnn12 |
| InChI | InChI=1S/C17H16F3N3/c1-2-3-5-14-6-4-7-15-16(21-22-23(14)15)12-8-10-13(11-9-12)17(18,19)20/h4,6-11H,2-3,5H2,1H3 |
| InChIKey | MLGBXGKUQJSGQM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |