C30H30Br2O8 — CID 139042289
ethyl (1S,4R,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 139042289) has the molecular formula C30H30Br2O8 and a molecular weight of 678.37 g/mol. Its IUPAC name is ethyl (1S,4R,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | ethyl (1S,4R,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 139042289 |
| Molecular Formula | C30H30Br2O8 |
| Molecular Weight | 678.37 g/mol |
| Exact Mass | 676.03 |
| IUPAC Name | ethyl (1S,4R,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]2C(=O)O[C@@]21c1ccc(Br)cc1.CCOC(=O)[C@@H]1CC[C@@H]2C(=O)O[C@@]21c1ccc(Br)cc1 |
| InChI | InChI=1S/2C15H15BrO4/c2*1-2-19-13(17)11-7-8-12-14(18)20-15(11,12)9-3-5-10(16)6-4-9/h2*3-6,11-12H,2,7-8H2,1H3/t2*11-,12+,15+/m00/s1 |
| InChIKey | ARVSAEWVBSDRME-DNCAAUDISA-N |
| XLogP | 5.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|