C15H15BrO4 — CID 139042290
ethyl (1S,4S,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 139042290) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is ethyl (1S,4S,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | ethyl (1S,4S,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 139042290 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | ethyl (1S,4S,5S)-5-(4-bromophenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H]2C(=O)O[C@]12c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrO4/c1-2-19-13(17)11-7-8-12-14(18)20-15(11,12)9-3-5-10(16)6-4-9/h3-6,11-12H,2,7-8H2,1H3/t11-,12-,15-/m1/s1 |
| InChIKey | WOGRRQMZUJQIDR-LALPHHSUSA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|