C17H18O4 — CID 166439149
benzyl (1S,4R,5S)-5-cyclopropyl-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 166439149) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is benzyl (1S,4R,5S)-5-cyclopropyl-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | benzyl (1S,4R,5S)-5-cyclopropyl-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 166439149 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | benzyl (1S,4R,5S)-5-cyclopropyl-7-oxo-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | O=C1O[C@@]2(C3CC3)[C@@H]1CC[C@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H18O4/c18-15(20-10-11-4-2-1-3-5-11)13-8-9-14-16(19)21-17(13,14)12-6-7-12/h1-5,12-14H,6-10H2/t13-,14+,17+/m0/s1 |
| InChIKey | VIVVTDVXULNQFL-JJRVBVJISA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|