C21H28O5 — CID 134940356
cis-dimethyl (3R,4S)-3-[(S)-methoxy(phenyl)methyl]-4-(2-methylprop-1-enyl)cyclopentane-1,1-dicarboxylate (PubChem CID 134940356) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is cis-dimethyl (3R,4S)-3-[(S)-methoxy(phenyl)methyl]-4-(2-methylprop-1-enyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3R,4S)-3-[(S)-methoxy(phenyl)methyl]-4-(2-methylprop-1-enyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134940356 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | cis-dimethyl (3R,4S)-3-[(S)-methoxy(phenyl)methyl]-4-(2-methylprop-1-enyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]([C@H](OC)c2ccccc2)[C@H](C=C(C)C)C1 |
| InChI | InChI=1S/C21H28O5/c1-14(2)11-16-12-21(19(22)25-4,20(23)26-5)13-17(16)18(24-3)15-9-7-6-8-10-15/h6-11,16-18H,12-13H2,1-5H3/t16-,17-,18-/m1/s1 |
| InChIKey | NJRXCJIWCXRHJI-KZNAEPCWSA-N |
| XLogP | 3.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|