C17H19FO5 — CID 11088553
diethyl 2-(4-fluorophenyl)-4-methylideneoxolane-3,3-dicarboxylate (PubChem CID 11088553) has the molecular formula C17H19FO5 and a molecular weight of 322.33 g/mol. Its IUPAC name is diethyl 2-(4-fluorophenyl)-4-methylideneoxolane-3,3-dicarboxylate.
| Compound Name | diethyl 2-(4-fluorophenyl)-4-methylideneoxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11088553 |
| Molecular Formula | C17H19FO5 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | diethyl 2-(4-fluorophenyl)-4-methylideneoxolane-3,3-dicarboxylate |
| SMILES | C=C1COC(c2ccc(F)cc2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H19FO5/c1-4-21-15(19)17(16(20)22-5-2)11(3)10-23-14(17)12-6-8-13(18)9-7-12/h6-9,14H,3-5,10H2,1-2H3 |
| InChIKey | RDJRIEGQIYPDLQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|