C22H28O5 — CID 102186321
dimethyl (3aR,8aS)-8a-(phenylmethoxymethyl)-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate (PubChem CID 102186321) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is dimethyl (3aR,8aS)-8a-(phenylmethoxymethyl)-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,8aS)-8a-(phenylmethoxymethyl)-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102186321 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | dimethyl (3aR,8aS)-8a-(phenylmethoxymethyl)-1,3,3a,6,7,8-hexahydroazulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2C=CCCC[C@]2(COCc2ccccc2)C1 |
| InChI | InChI=1S/C22H28O5/c1-25-19(23)22(20(24)26-2)13-18-11-7-4-8-12-21(18,15-22)16-27-14-17-9-5-3-6-10-17/h3,5-7,9-11,18H,4,8,12-16H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | QTNABXOFTRKMFB-GHTZIAJQSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|