C16H31NO3 — CID 139042311
tert-butyl N-[(4S,5S)-5-hydroxy-2,6,6-trimethyloct-7-en-4-yl]carbamate (PubChem CID 139042311) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-5-hydroxy-2,6,6-trimethyloct-7-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-5-hydroxy-2,6,6-trimethyloct-7-en-4-yl]carbamate |
|---|---|
| PubChem CID | 139042311 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-[(4S,5S)-5-hydroxy-2,6,6-trimethyloct-7-en-4-yl]carbamate |
| SMILES | C=CC(C)(C)[C@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-9-16(7,8)13(18)12(10-11(2)3)17-14(19)20-15(4,5)6/h9,11-13,18H,1,10H2,2-8H3,(H,17,19)/t12-,13+/m0/s1 |
| InChIKey | LQCGNALGAFPMBX-QWHCGFSZSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|