C29H26F6N2O6S2 — CID 139043051
8,20-diazoniahexacyclo[14.13.0.02,13.03,8.020,29.023,28]nonacosa-1(16),2(13),3,5,7,14,20(29),21,23,25,27-undecaene;bis(trifluoromethanesulfonate) (PubChem CID 139043051) has the molecular formula C29H26F6N2O6S2 and a molecular weight of 676.66 g/mol. Its IUPAC name is 8,20-diazoniahexacyclo[14.13.0.02,13.03,8.020,29.023,28]nonacosa-1(16),2(13),3,5,7,14,20(29),21,23,25,27-undecaene;bis(trifluoromethanesulfonate).
| Compound Name | 8,20-diazoniahexacyclo[14.13.0.02,13.03,8.020,29.023,28]nonacosa-1(16),2(13),3,5,7,14,20(29),21,23,25,27-undecaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139043051 |
| Molecular Formula | C29H26F6N2O6S2 |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | 8,20-diazoniahexacyclo[14.13.0.02,13.03,8.020,29.023,28]nonacosa-1(16),2(13),3,5,7,14,20(29),21,23,25,27-undecaene;bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1cc[n+]2c(c1)-c1c(ccc3c1-c1c4ccccc4cc[n+]1CCC3)CCCC2 |
| InChI | InChI=1S/C27H26N2.2CHF3O3S/c1-2-11-23-20(8-1)15-19-29-18-7-10-22-14-13-21-9-3-5-16-28-17-6-4-12-24(28)25(21)26(22)27(23)29;2*2-1(3,4)8(5,6)7/h1-2,4,6,8,11-15,17,19H,3,5,7,9-10,16,18H2;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | QFZXFILDBNQXJN-UHFFFAOYSA-L |
| XLogP | 5.13 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|