C56H48N4O8 — CID 139043192
(1R,2S,3S,4R)-3,4-bis[(Z)-2-carboxyprop-1-enyl]-1,2-dimethylcyclobutane-1,2-dicarboxylic acid;bis(4-(8-pyridin-4-ylnaphthalen-1-yl)pyridine) (PubChem CID 139043192) has the molecular formula C56H48N4O8 and a molecular weight of 905.02 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3,4-bis[(Z)-2-carboxyprop-1-enyl]-1,2-dimethylcyclobutane-1,2-dicarboxylic acid;bis(4-(8-pyridin-4-ylnaphthalen-1-yl)pyridine).
| Compound Name | (1R,2S,3S,4R)-3,4-bis[(Z)-2-carboxyprop-1-enyl]-1,2-dimethylcyclobutane-1,2-dicarboxylic acid;bis(4-(8-pyridin-4-ylnaphthalen-1-yl)pyridine) |
|---|---|
| PubChem CID | 139043192 |
| Molecular Formula | C56H48N4O8 |
| Molecular Weight | 905.02 g/mol |
| Exact Mass | 904.35 |
| IUPAC Name | (1R,2S,3S,4R)-3,4-bis[(Z)-2-carboxyprop-1-enyl]-1,2-dimethylcyclobutane-1,2-dicarboxylic acid;bis(4-(8-pyridin-4-ylnaphthalen-1-yl)pyridine) |
| SMILES | C/C(=C/[C@@H]1[C@H](/C=C(/C)C(=O)O)[C@](C)(C(=O)O)[C@]1(C)C(=O)O)C(=O)O.c1cc(-c2ccncc2)c2c(-c3ccncc3)cccc2c1.c1cc(-c2ccncc2)c2c(-c3ccncc3)cccc2c1 |
| InChI | InChI=1S/2C20H14N2.C16H20O8/c2*1-3-17-4-2-6-19(16-9-13-22-14-10-16)20(17)18(5-1)15-7-11-21-12-8-15;1-7(11(17)18)5-9-10(6-8(2)12(19)20)16(4,14(23)24)15(9,3)13(21)22/h2*1-14H;5-6,9-10H,1-4H3,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/b;;7-5-,8-6-/t;;9-,10+,15+,16- |
| InChIKey | XJXCPXFVNVZIGJ-JOKYOREVSA-N |
| XLogP | 11.40 |
| TPSA | 200.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.02 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|