C60H39N9O3S3 — CID 139043299
4-(4-methoxyphenyl)-7-(2-pyridin-3-ylethynyl)-2,1,3-benzothiadiazole (PubChem CID 139043299) has the molecular formula C60H39N9O3S3 and a molecular weight of 1030.23 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7-(2-pyridin-3-ylethynyl)-2,1,3-benzothiadiazole.
| Compound Name | 4-(4-methoxyphenyl)-7-(2-pyridin-3-ylethynyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 139043299 |
| Molecular Formula | C60H39N9O3S3 |
| Molecular Weight | 1030.23 g/mol |
| Exact Mass | 1029.23 |
| IUPAC Name | 4-(4-methoxyphenyl)-7-(2-pyridin-3-ylethynyl)-2,1,3-benzothiadiazole |
| SMILES | COc1ccc(-c2ccc(C#Cc3cccnc3)c3nsnc23)cc1.COc1ccc(-c2ccc(C#Cc3cccnc3)c3nsnc23)cc1.COc1ccc(-c2ccc(C#Cc3cccnc3)c3nsnc23)cc1 |
| InChI | InChI=1S/3C20H13N3OS/c3*1-24-17-9-6-15(7-10-17)18-11-8-16(19-20(18)23-25-22-19)5-4-14-3-2-12-21-13-14/h3*2-3,6-13H,1H3 |
| InChIKey | HJXXPFVLCRPEPT-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 143.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.23 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|