C20H13N3OS — CID 101433970
4-(4-methoxyphenyl)-7-(2-pyridin-2-ylethynyl)-2,1,3-benzothiadiazole (PubChem CID 101433970) has the molecular formula C20H13N3OS and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7-(2-pyridin-2-ylethynyl)-2,1,3-benzothiadiazole.
| Compound Name | 4-(4-methoxyphenyl)-7-(2-pyridin-2-ylethynyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 101433970 |
| Molecular Formula | C20H13N3OS |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-7-(2-pyridin-2-ylethynyl)-2,1,3-benzothiadiazole |
| SMILES | COc1ccc(-c2ccc(C#Cc3ccccn3)c3nsnc23)cc1 |
| InChI | InChI=1S/C20H13N3OS/c1-24-17-10-6-14(7-11-17)18-12-8-15(19-20(18)23-25-22-19)5-9-16-4-2-3-13-21-16/h2-4,6-8,10-13H,1H3 |
| InChIKey | GRAISGLPRHQFJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|