About cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide)
cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) (PubChem CID 139043845) has the molecular formula C42H38CoN4
and a molecular weight of 657.73 g/mol. Its IUPAC name is cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide).
Molecular Properties
| Compound Name | cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) |
| PubChem CID | 139043845 |
| Molecular Formula | C42H38CoN4 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) |
| SMILES | Cc1cccc(C)c1[N-]/C(=C\c1ccccn1)c1ccccc1.Cc1cccc(C)c1[N-]/C(=C\c1ccccn1)c1ccccc1.[Co+2] |
| InChI | InChI=1S/2C21H19N2.Co/c2*1-16-9-8-10-17(2)21(16)23-20(18-11-4-3-5-12-18)15-19-13-6-7-14-22-19;/h2*3-15H,1-2H3;/q2*-1;+2/b2*20-15-; |
| InChIKey | FEDOYUPAJYNXMJ-YTKRQRDXSA-N |
| XLogP | 11.80 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide)?
The IUPAC name of cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) (CID 139043845) is cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide).
What is the SMILES notation for cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide)?
The canonical SMILES for cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) is Cc1cccc(C)c1[N-]/C(=C\c1ccccn1)c1ccccc1.Cc1cccc(C)c1[N-]/C(=C\c1ccccn1)c1ccccc1.[Co+2].
What is the InChIKey of cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide)?
The InChIKey is FEDOYUPAJYNXMJ-YTKRQRDXSA-N. The full InChI is InChI=1S/2C21H19N2.Co/c2*1-16-9-8-10-17(2)21(16)23-20(18-11-4-3-5-12-18)15-19-13-6-7-14-22-19;/h2*3-15H,1-2H3;/q2*-1;+2/b2*20-15-;.
What are the key properties of cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide)?
cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) has a molecular weight of 657.73 g/mol, XLogP of 11.80, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis((2,6-dimethylphenyl)-[(Z)-1-phenyl-2-pyridin-2-ylethenyl]azanide) is sourced from PubChem (CID 139043845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).