C20H20CuN4O4 — CID 139044015
copper;2-tert-butyl-6-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenolate;nitrate (PubChem CID 139044015) has the molecular formula C20H20CuN4O4 and a molecular weight of 443.95 g/mol. Its IUPAC name is copper;2-tert-butyl-6-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenolate;nitrate.
| Compound Name | copper;2-tert-butyl-6-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenolate;nitrate |
|---|---|
| PubChem CID | 139044015 |
| Molecular Formula | C20H20CuN4O4 |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | copper;2-tert-butyl-6-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenolate;nitrate |
| SMILES | CC(C)(C)c1cccc(/C=N/Nc2ccc3ccccc3n2)c1[O-].O=[N+]([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C20H21N3O.Cu.NO3/c1-20(2,3)16-9-6-8-15(19(16)24)13-21-23-18-12-11-14-7-4-5-10-17(14)22-18;;2-1(3)4/h4-13,24H,1-3H3,(H,22,23);;/q;+2;-1/p-1/b21-13+;; |
| InChIKey | LVWZGJVLKYKOEK-ORKRDPRMSA-M |
| XLogP | 3.81 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|