C22H24N6O — CID 139044018
4-tert-butyl-2,6-bis[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol (PubChem CID 139044018) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 4-tert-butyl-2,6-bis[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 139044018 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-tert-butyl-2,6-bis[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/Nc2ccccn2)c(O)c(/C=N/Nc2ccccn2)c1 |
| InChI | InChI=1S/C22H24N6O/c1-22(2,3)18-12-16(14-25-27-19-8-4-6-10-23-19)21(29)17(13-18)15-26-28-20-9-5-7-11-24-20/h4-15,29H,1-3H3,(H,23,27)(H,24,28)/b25-14+,26-15+ |
| InChIKey | YDEHZADCFKJOAR-LVSXPEEVSA-N |
| XLogP | 4.37 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|