C42H32O6S2 — CID 139047551
5-methylsulfonyl-2,3-diphenyl-1-benzofuran (PubChem CID 139047551) has the molecular formula C42H32O6S2 and a molecular weight of 696.85 g/mol. Its IUPAC name is 5-methylsulfonyl-2,3-diphenyl-1-benzofuran.
| Compound Name | 5-methylsulfonyl-2,3-diphenyl-1-benzofuran |
|---|---|
| PubChem CID | 139047551 |
| Molecular Formula | C42H32O6S2 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.16 |
| IUPAC Name | 5-methylsulfonyl-2,3-diphenyl-1-benzofuran |
| SMILES | CS(=O)(=O)c1ccc2oc(-c3ccccc3)c(-c3ccccc3)c2c1.CS(=O)(=O)c1ccc2oc(-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/2C21H16O3S/c2*1-25(22,23)17-12-13-19-18(14-17)20(15-8-4-2-5-9-15)21(24-19)16-10-6-3-7-11-16/h2*2-14H,1H3 |
| InChIKey | PRQOCACJECHSBB-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |