C24H14F2O5S2 — CID 148774482
4,6-bis[(4-fluorophenyl)sulfonyl]dibenzofuran (PubChem CID 148774482) has the molecular formula C24H14F2O5S2 and a molecular weight of 484.50 g/mol. Its IUPAC name is 4,6-bis[(4-fluorophenyl)sulfonyl]dibenzofuran.
| Compound Name | 4,6-bis[(4-fluorophenyl)sulfonyl]dibenzofuran |
|---|---|
| PubChem CID | 148774482 |
| Molecular Formula | C24H14F2O5S2 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 4,6-bis[(4-fluorophenyl)sulfonyl]dibenzofuran |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1cccc2c1oc1c(S(=O)(=O)c3ccc(F)cc3)cccc12 |
| InChI | InChI=1S/C24H14F2O5S2/c25-15-7-11-17(12-8-15)32(27,28)21-5-1-3-19-20-4-2-6-22(24(20)31-23(19)21)33(29,30)18-13-9-16(26)10-14-18/h1-14H |
| InChIKey | OJBOKKQEPYFENZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |