C10H12F4N2O — CID 139047958
(7S,8R)-8-ethyl-5,5,6,6-tetrafluoro-7-methyl-7H-imidazo[1,2-a]pyridin-8-ol (PubChem CID 139047958) has the molecular formula C10H12F4N2O and a molecular weight of 252.21 g/mol. Its IUPAC name is (7S,8R)-8-ethyl-5,5,6,6-tetrafluoro-7-methyl-7H-imidazo[1,2-a]pyridin-8-ol.
| Compound Name | (7S,8R)-8-ethyl-5,5,6,6-tetrafluoro-7-methyl-7H-imidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 139047958 |
| Molecular Formula | C10H12F4N2O |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (7S,8R)-8-ethyl-5,5,6,6-tetrafluoro-7-methyl-7H-imidazo[1,2-a]pyridin-8-ol |
| SMILES | CC[C@]1(O)c2nccn2C(F)(F)C(F)(F)[C@H]1C |
| InChI | InChI=1S/C10H12F4N2O/c1-3-8(17)6(2)9(11,12)10(13,14)16-5-4-15-7(8)16/h4-6,17H,3H2,1-2H3/t6-,8+/m0/s1 |
| InChIKey | GVERSRAYFFBDPI-POYBYMJQSA-N |
| XLogP | 2.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|