C19H18Cl2N2O3S — CID 139047987
(NE)-N-[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-methylpropane-2-sulfonamide (PubChem CID 139047987) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is (NE)-N-[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-methylpropane-2-sulfonamide.
| Compound Name | (NE)-N-[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 139047987 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (NE)-N-[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)/N=C1/C(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c1-19(2,3)27(25,26)22-17-12-7-4-5-10-16(12)23(18(17)24)11-13-14(20)8-6-9-15(13)21/h4-10H,11H2,1-3H3/b22-17+ |
| InChIKey | VTDSBWNHHFZOMM-OQKWZONESA-N |
| XLogP | 4.46 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|