C21H13Cl2FN2O — CID 3692930
1-[(2,6-dichlorophenyl)methyl]-3-(4-fluorophenyl)iminoindol-2-one (PubChem CID 3692930) has the molecular formula C21H13Cl2FN2O and a molecular weight of 399.25 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-3-(4-fluorophenyl)iminoindol-2-one.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-3-(4-fluorophenyl)iminoindol-2-one |
|---|---|
| PubChem CID | 3692930 |
| Molecular Formula | C21H13Cl2FN2O |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3-(4-fluorophenyl)iminoindol-2-one |
| SMILES | O=C1/C(=N/c2ccc(F)cc2)c2ccccc2N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H13Cl2FN2O/c22-17-5-3-6-18(23)16(17)12-26-19-7-2-1-4-15(19)20(21(26)27)25-14-10-8-13(24)9-11-14/h1-11H,12H2/b25-20+ |
| InChIKey | WRQCOCYBTYNQBH-LKUDQCMESA-N |
| XLogP | 5.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|