C16H10FNO3S — CID 139048542
7-fluoro-2-methyl-1,1-dioxophenanthro[9,10-d][1,2]thiazol-3-one (PubChem CID 139048542) has the molecular formula C16H10FNO3S and a molecular weight of 315.32 g/mol. Its IUPAC name is 7-fluoro-2-methyl-1,1-dioxophenanthro[9,10-d][1,2]thiazol-3-one.
| Compound Name | 7-fluoro-2-methyl-1,1-dioxophenanthro[9,10-d][1,2]thiazol-3-one |
|---|---|
| PubChem CID | 139048542 |
| Molecular Formula | C16H10FNO3S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 7-fluoro-2-methyl-1,1-dioxophenanthro[9,10-d][1,2]thiazol-3-one |
| SMILES | CN1C(=O)c2c(c3ccccc3c3c(F)cccc23)S1(=O)=O |
| InChI | InChI=1S/C16H10FNO3S/c1-18-16(19)14-11-7-4-8-12(17)13(11)9-5-2-3-6-10(9)15(14)22(18,20)21/h2-8H,1H3 |
| InChIKey | TWDXJUGALNMULD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|