About 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate
4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate (PubChem CID 139048765) has the molecular formula C24H20N2O6
and a molecular weight of 432.43 g/mol. Its IUPAC name is 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate.
Molecular Properties
| Compound Name | 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate |
| PubChem CID | 139048765 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate |
| SMILES | O.O.O=C([O-])c1ccc(-[n+]2ccc(-c3cc[n+](-c4ccc(C(=O)[O-])cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H16N2O4.2H2O/c27-23(28)19-1-5-21(6-2-19)25-13-9-17(10-14-25)18-11-15-26(16-12-18)22-7-3-20(4-8-22)24(29)30;;/h1-16H;2*1H2 |
| InChIKey | GRQDNLHAQPZLRC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 151.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate?
The IUPAC name of 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate (CID 139048765) is 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate.
What is the SMILES notation for 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate?
The canonical SMILES for 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate is O.O.O=C([O-])c1ccc(-[n+]2ccc(-c3cc[n+](-c4ccc(C(=O)[O-])cc4)cc3)cc2)cc1.
What is the InChIKey of 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate?
The InChIKey is GRQDNLHAQPZLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2O4.2H2O/c27-23(28)19-1-5-21(6-2-19)25-13-9-17(10-14-25)18-11-15-26(16-12-18)22-7-3-20(4-8-22)24(29)30;;/h1-16H;2*1H2.
What are the key properties of 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate?
4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate has a molecular weight of 432.43 g/mol, XLogP of -1.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1-(4-carboxylatophenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]benzoate;dihydrate is sourced from PubChem (CID 139048765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).