C26H22N2O2 — CID 139048963
(1S,2S)-N-methyl-1-(1-methylindol-3-yl)-3-oxo-N-phenyl-1,2-dihydroindene-2-carboxamide (PubChem CID 139048963) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (1S,2S)-N-methyl-1-(1-methylindol-3-yl)-3-oxo-N-phenyl-1,2-dihydroindene-2-carboxamide.
| Compound Name | (1S,2S)-N-methyl-1-(1-methylindol-3-yl)-3-oxo-N-phenyl-1,2-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 139048963 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (1S,2S)-N-methyl-1-(1-methylindol-3-yl)-3-oxo-N-phenyl-1,2-dihydroindene-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1C(=O)c2ccccc2[C@H]1c1cn(C)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O2/c1-27-16-21(18-12-8-9-15-22(18)27)23-19-13-6-7-14-20(19)25(29)24(23)26(30)28(2)17-10-4-3-5-11-17/h3-16,23-24H,1-2H3/t23-,24-/m0/s1 |
| InChIKey | WYBYEIAUJZDIPW-ZEQRLZLVSA-N |
| XLogP | 4.79 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|