C19H22O4 — CID 139048995
(1R,4S,11S,13R,16S)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadeca-2(7),9-diene-6,15-dione (PubChem CID 139048995) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1R,4S,11S,13R,16S)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadeca-2(7),9-diene-6,15-dione.
| Compound Name | (1R,4S,11S,13R,16S)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadeca-2(7),9-diene-6,15-dione |
|---|---|
| PubChem CID | 139048995 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1R,4S,11S,13R,16S)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadeca-2(7),9-diene-6,15-dione |
| SMILES | C=C(C)[C@@H]1CC(=O)C2=C(C1)[C@@H]1C(=O)O[C@@H]3C[C@](C)(O)C(=CC2)[C@H]13 |
| InChI | InChI=1S/C19H22O4/c1-9(2)10-6-12-11(14(20)7-10)4-5-13-17-15(8-19(13,3)22)23-18(21)16(12)17/h5,10,15-17,22H,1,4,6-8H2,2-3H3/t10-,15+,16-,17-,19-/m0/s1 |
| InChIKey | UUIWWHIBWFPKLD-CUINPSOFSA-N |
| XLogP | 2.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|