C32H35N3O5 — CID 139049181
(Z)-2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]-3-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]prop-2-enenitrile (PubChem CID 139049181) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is (Z)-2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]-3-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]-3-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 139049181 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (Z)-2-[4-[(2-hydroxyphenyl)methylideneamino]phenyl]-3-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(N2CCOCCOCCOCCOCC2)cc1)c1ccc(/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C32H35N3O5/c33-24-29(27-7-9-30(10-8-27)34-25-28-3-1-2-4-32(28)36)23-26-5-11-31(12-6-26)35-13-15-37-17-19-39-21-22-40-20-18-38-16-14-35/h1-12,23,25,36H,13-22H2/b29-23+,34-25+ |
| InChIKey | BZNDOWJLCAZYJE-XCXIPGRDSA-N |
| XLogP | 5.09 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|