About 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine
1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine (PubChem CID 139049240) has the molecular formula C20H38N6
and a molecular weight of 362.57 g/mol. Its IUPAC name is 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 139049240 |
| Molecular Formula | C20H38N6 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc(CN(C)C)[nH]1.CN(C)Cc1ccc(CN(C)C)[nH]1 |
| InChI | InChI=1S/2C10H19N3/c2*1-12(2)7-9-5-6-10(11-9)8-13(3)4/h2*5-6,11H,7-8H2,1-4H3 |
| InChIKey | XINFTHGLTIGXOZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine (CID 139049240) is 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine is CN(C)Cc1ccc(CN(C)C)[nH]1.CN(C)Cc1ccc(CN(C)C)[nH]1.
What is the InChIKey of 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine?
The InChIKey is XINFTHGLTIGXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H19N3/c2*1-12(2)7-9-5-6-10(11-9)8-13(3)4/h2*5-6,11H,7-8H2,1-4H3.
What are the key properties of 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine?
1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine has a molecular weight of 362.57 g/mol, XLogP of 2.28, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 139049240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).