C44H36N4O6S2 — CID 139049350
ethyl 13-amino-11-(furan-2-yl)-15-thia-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-14-carboxylate (PubChem CID 139049350) has the molecular formula C44H36N4O6S2 and a molecular weight of 780.93 g/mol. Its IUPAC name is ethyl 13-amino-11-(furan-2-yl)-15-thia-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-14-carboxylate.
| Compound Name | ethyl 13-amino-11-(furan-2-yl)-15-thia-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-14-carboxylate |
|---|---|
| PubChem CID | 139049350 |
| Molecular Formula | C44H36N4O6S2 |
| Molecular Weight | 780.93 g/mol |
| Exact Mass | 780.21 |
| IUPAC Name | ethyl 13-amino-11-(furan-2-yl)-15-thia-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-14-carboxylate |
| SMILES | CCOC(=O)c1sc2nc3c(c(-c4ccco4)c2c1N)CCc1ccccc1-3.CCOC(=O)c1sc2nc3c(c(-c4ccco4)c2c1N)CCc1ccccc1-3 |
| InChI | InChI=1S/2C22H18N2O3S/c2*1-2-26-22(25)20-18(23)17-16(15-8-5-11-27-15)14-10-9-12-6-3-4-7-13(12)19(14)24-21(17)28-20/h2*3-8,11H,2,9-10,23H2,1H3 |
| InChIKey | KWDUTSNUMGHTSE-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.93 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |