C24H24BF10N3O2 — CID 139049473
5,5-bis(2,3,4,5,6-pentafluorophenyl)-2-[(2S)-1-(2,2,6,6-tetramethylpiperidin-1-yl)propan-2-yl]-1,4-dioxa-3-aza-2-azonia-5-boranuidacyclopent-2-ene (PubChem CID 139049473) has the molecular formula C24H24BF10N3O2 and a molecular weight of 587.27 g/mol. Its IUPAC name is 5,5-bis(2,3,4,5,6-pentafluorophenyl)-2-[(2S)-1-(2,2,6,6-tetramethylpiperidin-1-yl)propan-2-yl]-1,4-dioxa-3-aza-2-azonia-5-boranuidacyclopent-2-ene.
| Compound Name | 5,5-bis(2,3,4,5,6-pentafluorophenyl)-2-[(2S)-1-(2,2,6,6-tetramethylpiperidin-1-yl)propan-2-yl]-1,4-dioxa-3-aza-2-azonia-5-boranuidacyclopent-2-ene |
|---|---|
| PubChem CID | 139049473 |
| Molecular Formula | C24H24BF10N3O2 |
| Molecular Weight | 587.27 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | 5,5-bis(2,3,4,5,6-pentafluorophenyl)-2-[(2S)-1-(2,2,6,6-tetramethylpiperidin-1-yl)propan-2-yl]-1,4-dioxa-3-aza-2-azonia-5-boranuidacyclopent-2-ene |
| SMILES | C[C@@H](CN1C(C)(C)CCCC1(C)C)[N+]1=NO[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)O1 |
| InChI | InChI=1S/C24H24BF10N3O2/c1-10(9-37-23(2,3)7-6-8-24(37,4)5)38-36-39-25(40-38,11-13(26)17(30)21(34)18(31)14(11)27)12-15(28)19(32)22(35)20(33)16(12)29/h10H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | AATOJVWOPUYOPP-JTQLQIEISA-N |
| XLogP | 5.41 |
| TPSA | 37.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.27 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|