C11H16O3 — CID 139049676
(3aS,8aS)-5,5,8a-trimethyl-3a,6-dihydro-3H-furo[3,2-b]oxepin-2-one (PubChem CID 139049676) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3aS,8aS)-5,5,8a-trimethyl-3a,6-dihydro-3H-furo[3,2-b]oxepin-2-one.
| Compound Name | (3aS,8aS)-5,5,8a-trimethyl-3a,6-dihydro-3H-furo[3,2-b]oxepin-2-one |
|---|---|
| PubChem CID | 139049676 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3aS,8aS)-5,5,8a-trimethyl-3a,6-dihydro-3H-furo[3,2-b]oxepin-2-one |
| SMILES | CC1(C)CC=C[C@]2(C)OC(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C11H16O3/c1-10(2)5-4-6-11(3)8(13-10)7-9(12)14-11/h4,6,8H,5,7H2,1-3H3/t8-,11-/m0/s1 |
| InChIKey | XBRLPHMOSNFJDG-KWQFWETISA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|