C15H16O3 — CID 139050057
(1R,2R,9R,10R,14R)-2-methyl-15-oxatetracyclo[7.4.2.01,10.06,14]pentadeca-4,6-diene-8,11-dione (PubChem CID 139050057) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1R,2R,9R,10R,14R)-2-methyl-15-oxatetracyclo[7.4.2.01,10.06,14]pentadeca-4,6-diene-8,11-dione.
| Compound Name | (1R,2R,9R,10R,14R)-2-methyl-15-oxatetracyclo[7.4.2.01,10.06,14]pentadeca-4,6-diene-8,11-dione |
|---|---|
| PubChem CID | 139050057 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1R,2R,9R,10R,14R)-2-methyl-15-oxatetracyclo[7.4.2.01,10.06,14]pentadeca-4,6-diene-8,11-dione |
| SMILES | C[C@@H]1CC=CC2=CC(=O)[C@@H]3O[C@H]2[C@]12CCC(=O)[C@@H]32 |
| InChI | InChI=1S/C15H16O3/c1-8-3-2-4-9-7-11(17)13-12-10(16)5-6-15(8,12)14(9)18-13/h2,4,7-8,12-14H,3,5-6H2,1H3/t8-,12+,13+,14-,15-/m1/s1 |
| InChIKey | VMEBCQHZVPAORX-JMEDSEKFSA-N |
| XLogP | 1.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |