C27H28N2O — CID 139050275
1-[3-(4-tert-butylphenyl)-1-pyridin-2-ylindol-2-yl]butan-1-one (PubChem CID 139050275) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)-1-pyridin-2-ylindol-2-yl]butan-1-one.
| Compound Name | 1-[3-(4-tert-butylphenyl)-1-pyridin-2-ylindol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 139050275 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)-1-pyridin-2-ylindol-2-yl]butan-1-one |
| SMILES | CCCC(=O)c1c(-c2ccc(C(C)(C)C)cc2)c2ccccc2n1-c1ccccn1 |
| InChI | InChI=1S/C27H28N2O/c1-5-10-23(30)26-25(19-14-16-20(17-15-19)27(2,3)4)21-11-6-7-12-22(21)29(26)24-13-8-9-18-28-24/h6-9,11-18H,5,10H2,1-4H3 |
| InChIKey | SLJGMEFDQRJNNQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |