C30H22N2O3 — CID 166443047
3,4-bis(4-acetylphenyl)-1-pyridin-2-ylquinolin-2-one (PubChem CID 166443047) has the molecular formula C30H22N2O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 3,4-bis(4-acetylphenyl)-1-pyridin-2-ylquinolin-2-one.
| Compound Name | 3,4-bis(4-acetylphenyl)-1-pyridin-2-ylquinolin-2-one |
|---|---|
| PubChem CID | 166443047 |
| Molecular Formula | C30H22N2O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3,4-bis(4-acetylphenyl)-1-pyridin-2-ylquinolin-2-one |
| SMILES | CC(=O)c1ccc(-c2c(-c3ccc(C(C)=O)cc3)c3ccccc3n(-c3ccccn3)c2=O)cc1 |
| InChI | InChI=1S/C30H22N2O3/c1-19(33)21-10-14-23(15-11-21)28-25-7-3-4-8-26(25)32(27-9-5-6-18-31-27)30(35)29(28)24-16-12-22(13-17-24)20(2)34/h3-18H,1-2H3 |
| InChIKey | MBRIUGPGDJFOOQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |