C32H40BNO3Si — CID 139050325
4-[tert-butyl(dimethyl)silyl]oxy-2-naphthalen-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine (PubChem CID 139050325) has the molecular formula C32H40BNO3Si and a molecular weight of 525.57 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-naphthalen-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-naphthalen-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 139050325 |
| Molecular Formula | C32H40BNO3Si |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-naphthalen-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
| SMILES | CC1(C)OB(c2c(-c3cccc4ccccc34)c(N)c3ccccc3c2O[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C32H40BNO3Si/c1-30(2,3)38(8,9)35-29-25-19-13-12-18-24(25)28(34)26(23-20-14-16-21-15-10-11-17-22(21)23)27(29)33-36-31(4,5)32(6,7)37-33/h10-20H,34H2,1-9H3 |
| InChIKey | PDFNMPOKDJMZSF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|