C29H33NOSi — CID 132522230
4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)-3-phenylnaphthalen-1-amine (PubChem CID 132522230) has the molecular formula C29H33NOSi and a molecular weight of 439.68 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)-3-phenylnaphthalen-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)-3-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 132522230 |
| Molecular Formula | C29H33NOSi |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)-3-phenylnaphthalen-1-amine |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)c(O[Si](C)(C)C(C)(C)C)c3ccccc3c2N)cc1 |
| InChI | InChI=1S/C29H33NOSi/c1-20-16-18-22(19-17-20)25-26(21-12-8-7-9-13-21)28(31-32(5,6)29(2,3)4)24-15-11-10-14-23(24)27(25)30/h7-19H,30H2,1-6H3 |
| InChIKey | FLORBTOUHDDBLV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|