C18H11F3I3N5 — CID 139050437
3-[[2-(1H-imidazol-2-yl)imidazol-1-yl]methyl]pyridine;1,3,5-trifluoro-2,4,6-triiodobenzene (PubChem CID 139050437) has the molecular formula C18H11F3I3N5 and a molecular weight of 735.03 g/mol. Its IUPAC name is 3-[[2-(1H-imidazol-2-yl)imidazol-1-yl]methyl]pyridine;1,3,5-trifluoro-2,4,6-triiodobenzene.
| Compound Name | 3-[[2-(1H-imidazol-2-yl)imidazol-1-yl]methyl]pyridine;1,3,5-trifluoro-2,4,6-triiodobenzene |
|---|---|
| PubChem CID | 139050437 |
| Molecular Formula | C18H11F3I3N5 |
| Molecular Weight | 735.03 g/mol |
| Exact Mass | 734.81 |
| IUPAC Name | 3-[[2-(1H-imidazol-2-yl)imidazol-1-yl]methyl]pyridine;1,3,5-trifluoro-2,4,6-triiodobenzene |
| SMILES | Fc1c(I)c(F)c(I)c(F)c1I.c1cncc(Cn2ccnc2-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C12H11N5.C6F3I3/c1-2-10(8-13-3-1)9-17-7-6-16-12(17)11-14-4-5-15-11;7-1-4(10)2(8)6(12)3(9)5(1)11/h1-8H,9H2,(H,14,15); |
| InChIKey | YVCIZRPRUTZXST-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|