C11H10N4S — CID 15057077
2-(1H-imidazol-2-yl)-1-(thiophen-2-ylmethyl)imidazole (PubChem CID 15057077) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1-(thiophen-2-ylmethyl)imidazole.
| Compound Name | 2-(1H-imidazol-2-yl)-1-(thiophen-2-ylmethyl)imidazole |
|---|---|
| PubChem CID | 15057077 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1-(thiophen-2-ylmethyl)imidazole |
| SMILES | c1csc(Cn2ccnc2-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C11H10N4S/c1-2-9(16-7-1)8-15-6-5-14-11(15)10-12-3-4-13-10/h1-7H,8H2,(H,12,13) |
| InChIKey | SWCCCVGEPXCKHC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |