C16H21N5S — CID 16676839
3-imidazol-1-yl-N-(1H-imidazol-5-ylmethyl)-N-[(5-methylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 16676839) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(1H-imidazol-5-ylmethyl)-N-[(5-methylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-(1H-imidazol-5-ylmethyl)-N-[(5-methylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 16676839 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-imidazol-1-yl-N-(1H-imidazol-5-ylmethyl)-N-[(5-methylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | Cc1ccc(CN(CCCn2ccnc2)Cc2cnc[nH]2)s1 |
| InChI | InChI=1S/C16H21N5S/c1-14-3-4-16(22-14)11-21(10-15-9-18-12-19-15)7-2-6-20-8-5-17-13-20/h3-5,8-9,12-13H,2,6-7,10-11H2,1H3,(H,18,19) |
| InChIKey | WRLCRKLWLQJPLD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |