C17H21N3S2 — CID 16676786
3-imidazol-1-yl-N-[(5-methylthiophen-2-yl)methyl]-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 16676786) has the molecular formula C17H21N3S2 and a molecular weight of 331.51 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(5-methylthiophen-2-yl)methyl]-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[(5-methylthiophen-2-yl)methyl]-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 16676786 |
| Molecular Formula | C17H21N3S2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-imidazol-1-yl-N-[(5-methylthiophen-2-yl)methyl]-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | Cc1ccc(CN(CCCn2ccnc2)Cc2cccs2)s1 |
| InChI | InChI=1S/C17H21N3S2/c1-15-5-6-17(22-15)13-20(12-16-4-2-11-21-16)9-3-8-19-10-7-18-14-19/h2,4-7,10-11,14H,3,8-9,12-13H2,1H3 |
| InChIKey | CBOMDFQDBZMYBL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |