C34H36N8O6 — CID 139050774
1,3-dimethyl-7-[(1S)-1-phenylmethoxyprop-2-enyl]purine-2,6-dione (PubChem CID 139050774) has the molecular formula C34H36N8O6 and a molecular weight of 652.71 g/mol. Its IUPAC name is 1,3-dimethyl-7-[(1S)-1-phenylmethoxyprop-2-enyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[(1S)-1-phenylmethoxyprop-2-enyl]purine-2,6-dione |
|---|---|
| PubChem CID | 139050774 |
| Molecular Formula | C34H36N8O6 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 1,3-dimethyl-7-[(1S)-1-phenylmethoxyprop-2-enyl]purine-2,6-dione |
| SMILES | C=C[C@H](OCc1ccccc1)n1cnc2c1c(=O)n(C)c(=O)n2C.C=C[C@H](OCc1ccccc1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/2C17H18N4O3/c2*1-4-13(24-10-12-8-6-5-7-9-12)21-11-18-15-14(21)16(22)20(3)17(23)19(15)2/h2*4-9,11,13H,1,10H2,2-3H3/t2*13-/m00/s1 |
| InChIKey | GWNVCQBSIFDAOF-CHNGVTQJSA-N |
| XLogP | 2.67 |
| TPSA | 142.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|