C17H20F2O2 — CID 139051204
(5S)-5-[(4,4-difluorocyclohexyl)methyl]-5-phenyloxolan-2-one (PubChem CID 139051204) has the molecular formula C17H20F2O2 and a molecular weight of 294.34 g/mol. Its IUPAC name is (5S)-5-[(4,4-difluorocyclohexyl)methyl]-5-phenyloxolan-2-one.
| Compound Name | (5S)-5-[(4,4-difluorocyclohexyl)methyl]-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 139051204 |
| Molecular Formula | C17H20F2O2 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (5S)-5-[(4,4-difluorocyclohexyl)methyl]-5-phenyloxolan-2-one |
| SMILES | O=C1CC[C@](CC2CCC(F)(F)CC2)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H20F2O2/c18-17(19)10-6-13(7-11-17)12-16(9-8-15(20)21-16)14-4-2-1-3-5-14/h1-5,13H,6-12H2/t16-/m0/s1 |
| InChIKey | QFLMVIRLYKMNRL-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |