C34H42N2O6 — CID 139051298
ethyl 1-[(1R,2R)-2-hydroxycyclohexyl]indole-3-carboxylate (PubChem CID 139051298) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is ethyl 1-[(1R,2R)-2-hydroxycyclohexyl]indole-3-carboxylate.
| Compound Name | ethyl 1-[(1R,2R)-2-hydroxycyclohexyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 139051298 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | ethyl 1-[(1R,2R)-2-hydroxycyclohexyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@@H]2CCCC[C@H]2O)c2ccccc12.CCOC(=O)c1cn([C@@H]2CCCC[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/2C17H21NO3/c2*1-2-21-17(20)13-11-18(14-8-4-3-7-12(13)14)15-9-5-6-10-16(15)19/h2*3-4,7-8,11,15-16,19H,2,5-6,9-10H2,1H3/t2*15-,16-/m11/s1 |
| InChIKey | NVZOFQFZCSATBF-LDWSSDELSA-N |
| XLogP | 6.59 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |