C22H20ClFO — CID 139051344
(1R,2R)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-1-phenylbutan-1-ol (PubChem CID 139051344) has the molecular formula C22H20ClFO and a molecular weight of 354.85 g/mol. Its IUPAC name is (1R,2R)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-1-phenylbutan-1-ol.
| Compound Name | (1R,2R)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 139051344 |
| Molecular Formula | C22H20ClFO |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (1R,2R)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-1-phenylbutan-1-ol |
| SMILES | CC[C@H](c1ccc(F)cc1)[C@@](O)(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClFO/c1-2-21(16-8-14-20(24)15-9-16)22(25,17-6-4-3-5-7-17)18-10-12-19(23)13-11-18/h3-15,21,25H,2H2,1H3/t21-,22-/m1/s1 |
| InChIKey | GZRNPWZHWPHCFD-FGZHOGPDSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |