C24H41NO5 — CID 139052393
(2S,3S)-4-[(1S,4aS,4bS,6S,7S,8aS,10aS)-6,7-dihydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-2-amino-3-methoxybutanoic acid (PubChem CID 139052393) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is (2S,3S)-4-[(1S,4aS,4bS,6S,7S,8aS,10aS)-6,7-dihydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-2-amino-3-methoxybutanoic acid.
| Compound Name | (2S,3S)-4-[(1S,4aS,4bS,6S,7S,8aS,10aS)-6,7-dihydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-2-amino-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 139052393 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | (2S,3S)-4-[(1S,4aS,4bS,6S,7S,8aS,10aS)-6,7-dihydroxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthren-1-yl]-2-amino-3-methoxybutanoic acid |
| SMILES | CO[C@@H](C[C@H]1C(C)=CC[C@@H]2[C@]3(C)C[C@H](O)[C@@H](O)C(C)(C)[C@H]3CC[C@]21C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C24H41NO5/c1-13-7-8-18-23(4,14(13)11-16(30-6)19(25)21(28)29)10-9-17-22(2,3)20(27)15(26)12-24(17,18)5/h7,14-20,26-27H,8-12,25H2,1-6H3,(H,28,29)/t14-,15-,16-,17+,18-,19-,20+,23-,24+/m0/s1 |
| InChIKey | RPMUZTOMCMANNP-YDNHGFIYSA-N |
| XLogP | 2.96 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|