About palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine)
palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) (PubChem CID 139056007) has the molecular formula C16H12N6Pd
and a molecular weight of 394.73 g/mol. Its IUPAC name is palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine).
Molecular Properties
| Compound Name | palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) |
| PubChem CID | 139056007 |
| Molecular Formula | C16H12N6Pd |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) |
| SMILES | [Pd+2].c1ccc(-c2ccn[n-]2)nc1.c1ccc(-c2ccn[n-]2)nc1 |
| InChI | InChI=1S/2C8H6N3.Pd/c2*1-2-5-9-7(3-1)8-4-6-10-11-8;/h2*1-6H;/q2*-1;+2 |
| InChIKey | FAGDJVBTZCLJBA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine)?
The IUPAC name of palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) (CID 139056007) is palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine).
What is the SMILES notation for palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine)?
The canonical SMILES for palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) is [Pd+2].c1ccc(-c2ccn[n-]2)nc1.c1ccc(-c2ccn[n-]2)nc1.
What is the InChIKey of palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine)?
The InChIKey is FAGDJVBTZCLJBA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6N3.Pd/c2*1-2-5-9-7(3-1)8-4-6-10-11-8;/h2*1-6H;/q2*-1;+2.
What are the key properties of palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine)?
palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) has a molecular weight of 394.73 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);bis(2-pyrazol-2-id-3-ylpyridine) is sourced from PubChem (CID 139056007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).