C22H10F14N6Pt — CID 139138252
bis(2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrazol-1-id-3-yl]pyridine);platinum(2+) (PubChem CID 139138252) has the molecular formula C22H10F14N6Pt and a molecular weight of 819.41 g/mol. Its IUPAC name is bis(2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrazol-1-id-3-yl]pyridine);platinum(2+).
| Compound Name | bis(2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrazol-1-id-3-yl]pyridine);platinum(2+) |
|---|---|
| PubChem CID | 139138252 |
| Molecular Formula | C22H10F14N6Pt |
| Molecular Weight | 819.41 g/mol |
| Exact Mass | 819.04 |
| IUPAC Name | bis(2-[5-(1,1,2,2,3,3,3-heptafluoropropyl)pyrazol-1-id-3-yl]pyridine);platinum(2+) |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1cc(-c2ccccn2)n[n-]1.FC(F)(F)C(F)(F)C(F)(F)c1cc(-c2ccccn2)n[n-]1.[Pt+2] |
| InChI | InChI=1S/2C11H5F7N3.Pt/c2*12-9(13,10(14,15)11(16,17)18)8-5-7(20-21-8)6-3-1-2-4-19-6;/h2*1-5H;/q2*-1;+2 |
| InChIKey | NBXMEUFYMKIWNR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.41 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|