C21H15BF3N3 — CID 139181195
7,7-diphenyl-4-(trifluoromethyl)-5,6-diaza-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene (PubChem CID 139181195) has the molecular formula C21H15BF3N3 and a molecular weight of 377.18 g/mol. Its IUPAC name is 7,7-diphenyl-4-(trifluoromethyl)-5,6-diaza-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene.
| Compound Name | 7,7-diphenyl-4-(trifluoromethyl)-5,6-diaza-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
|---|---|
| PubChem CID | 139181195 |
| Molecular Formula | C21H15BF3N3 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 7,7-diphenyl-4-(trifluoromethyl)-5,6-diaza-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
| SMILES | FC(F)(F)c1cc2n(n1)[B-](c1ccccc1)(c1ccccc1)[n+]1ccccc1-2 |
| InChI | InChI=1S/C21H15BF3N3/c23-21(24,25)20-15-19-18-13-7-8-14-27(18)22(28(19)26-20,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15H |
| InChIKey | BQCPQZCGZYIRGG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|