C22H10F12N4Pt — CID 139127932
bis(2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine);platinum(2+) (PubChem CID 139127932) has the molecular formula C22H10F12N4Pt and a molecular weight of 753.40 g/mol. Its IUPAC name is bis(2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine);platinum(2+).
| Compound Name | bis(2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine);platinum(2+) |
|---|---|
| PubChem CID | 139127932 |
| Molecular Formula | C22H10F12N4Pt |
| Molecular Weight | 753.40 g/mol |
| Exact Mass | 753.04 |
| IUPAC Name | bis(2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine);platinum(2+) |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(-c2ccccn2)[n-]1.FC(F)(F)c1cc(C(F)(F)F)c(-c2ccccn2)[n-]1.[Pt+2] |
| InChI | InChI=1S/2C11H5F6N2.Pt/c2*12-10(13,14)6-5-8(11(15,16)17)19-9(6)7-3-1-2-4-18-7;/h2*1-5H;/q2*-1;+2 |
| InChIKey | DNCBSRQXHSVAEJ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.40 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |