C23H48O4Si4 — CID 139056514
dimethyl (3E,4R)-4-propan-2-yl-3-[tris(trimethylsilyl)silylmethylidene]cyclohexane-1,1-dicarboxylate (PubChem CID 139056514) has the molecular formula C23H48O4Si4 and a molecular weight of 500.98 g/mol. Its IUPAC name is dimethyl (3E,4R)-4-propan-2-yl-3-[tris(trimethylsilyl)silylmethylidene]cyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,4R)-4-propan-2-yl-3-[tris(trimethylsilyl)silylmethylidene]cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139056514 |
| Molecular Formula | C23H48O4Si4 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | dimethyl (3E,4R)-4-propan-2-yl-3-[tris(trimethylsilyl)silylmethylidene]cyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@H](C(C)C)/C(=C/[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C23H48O4Si4/c1-18(2)20-14-15-23(21(24)26-3,22(25)27-4)16-19(20)17-31(28(5,6)7,29(8,9)10)30(11,12)13/h17-18,20H,14-16H2,1-13H3/b19-17+/t20-/m1/s1 |
| InChIKey | LUGWGRLNMLOFIY-LFNFIXQYSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|