C24H18N2O2 — CID 139056594
2-(2-hydroxyphenyl)phenol;1,10-phenanthroline (PubChem CID 139056594) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)phenol;1,10-phenanthroline.
| Compound Name | 2-(2-hydroxyphenyl)phenol;1,10-phenanthroline |
|---|---|
| PubChem CID | 139056594 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(2-hydroxyphenyl)phenol;1,10-phenanthroline |
| SMILES | Oc1ccccc1-c1ccccc1O.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C12H10O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H;1-8,13-14H |
| InChIKey | ASGNXIOUNZHJLH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|